13657-68-6 Usage
Uses
Used in Fragrance and Flavor Industry:
Germacr-1(10)-ene-5,8-dione is used as a fragrance and flavor compound for its pleasant aroma. Its distinct scent makes it a valuable ingredient in the creation of various perfumes, colognes, and food flavorings.
Used in Medicine:
Germacr-1(10)-ene-5,8-dione is being studied for its potential therapeutic applications in medicine. Its anti-inflammatory, antimicrobial, and antioxidant properties suggest that it could be used to treat various health conditions, such as infections and inflammation-related disorders.
Used in Skincare Products:
Germacr-1(10)-ene-5,8-dione is also being explored for its potential use in skincare products. Its biological activities, including anti-inflammatory and antioxidant properties, may contribute to the development of skincare formulations that promote healthy skin and protect against environmental stressors.
Check Digit Verification of cas no
The CAS Registry Mumber 13657-68-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,3,6,5 and 7 respectively; the second part has 2 digits, 6 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 13657-68:
(7*1)+(6*3)+(5*6)+(4*5)+(3*7)+(2*6)+(1*8)=116
116 % 10 = 6
So 13657-68-6 is a valid CAS Registry Number.
InChI:InChI=1/C15H24O2/c1-10(2)13-9-14(16)12(4)7-5-6-11(3)8-15(13)17/h6,10,12-13H,5,7-9H2,1-4H3/b11-6+/t12-,13-/m0/s1
